CAS 1708401-43-7 is the registry number for 2-Chloro-6-methyl-4-phenyl-5,6,7,8-tetrahydro-1,6-naphthyridine-3-carbonitrile 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-chloro-6-methyl-4-phenyl-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile (CAS 1708401-43-7) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 2-chloro-6-methyl-4-phenyl-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile. InChIKey: XJNVHEZGCRWYRY-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 2-chloro-6-methyl-4-phenyl-7,8-dihydro-5H-1,6-naphthyridine-3-carbonitrile |
| InChIKey | XJNVHEZGCRWYRY-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C(=C(C(=N2)Cl)C#N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)