CAS 775350-99-7 is the registry number for Epinastine Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine (CAS 775350-99-7) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine. InChIKey: OHOWXEDRJQSBEY-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 16-chloro-2,4-diazatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),3,7,9,11,15,17-heptaen-3-amine |
| InChIKey | OHOWXEDRJQSBEY-UHFFFAOYSA-N |
| SMILES | C1C2C3=CC=CC=C3CC4=C(N2C(=N1)N)C=CC(=C4)Cl |
Computed by PubChem (NCBI)