Products 4393-72-0

CAS 4393-72-0 is the registry number for Desoxochlordiazepoxide. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 25mg, 50mg, 10 mg, 2.5 mg, 5 mg.

Structural formula: {0} (CAS {1})

7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine (CAS 4393-72-0) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine. InChIKey: FAMNQSVPYUAUAF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H14ClN3
Molecular weight283.75 g/mol
IUPAC name7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine
InChIKeyFAMNQSVPYUAUAF-UHFFFAOYSA-N
SMILESCN=C1CN=C(C2=C(N1)C=CC(=C2)Cl)C3=CC=CC=C3

Computed by PubChem (NCBI)