CAS 4393-72-0 is the registry number for Desoxochlordiazepoxide. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 2,5mg, 5mg, 25mg, 50mg, 10 mg, 2.5 mg, 5 mg.
7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine (CAS 4393-72-0) is a chemical compound with the molecular formula C16H14ClN3 and a molecular weight of 283.75 g/mol. IUPAC name: 7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine. InChIKey: FAMNQSVPYUAUAF-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 7-chloro-N-methyl-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| InChIKey | FAMNQSVPYUAUAF-UHFFFAOYSA-N |
| SMILES | CN=C1CN=C(C2=C(N1)C=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)