Products 1414861-21-4
CAS 1414861-21-4 appears in our catalog under these names: Antifungal agent 49, Antifungal agent 49, 99.48%, Antifungal agent 49. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 1 mg, 5 mg, 10 mg.
5-benzoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one (CAS 1414861-21-4) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 5-benzoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one. InChIKey: LBEOUJODZMOAIF-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 5-benzoyl-2,3-dihydroxy-6-methylcyclohepta-2,4,6-trien-1-one |
| InChIKey | LBEOUJODZMOAIF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(=C(C=C1C(=O)C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Antifungal agent 49, orb2278861