CAS 141661-39-4 is the registry number for Hemiacetylcarnitinium (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride (CAS 141661-39-4) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride. InChIKey: ZDNWCPDGSHXFCB-JXLXBRSFSA-N.
| Molecular formula | C9H18ClNO4 |
|---|---|
| Molecular weight | 239.69 g/mol |
| IUPAC name | 2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride |
| InChIKey | ZDNWCPDGSHXFCB-JXLXBRSFSA-N |
| SMILES | C[C@]1(C[N+](C[C@H](O1)CC(=O)O)(C)C)O.[Cl-] |
Computed by PubChem (NCBI)