Products 141661-39-4

CAS 141661-39-4 is the registry number for Hemiacetylcarnitinium (chloride). Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride (CAS 141661-39-4) is a chemical compound with the molecular formula C9H18ClNO4 and a molecular weight of 239.69 g/mol. IUPAC name: 2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride. InChIKey: ZDNWCPDGSHXFCB-JXLXBRSFSA-N.

Identity
Molecular formulaC9H18ClNO4
Molecular weight239.69 g/mol
IUPAC name2-[(2R,6S)-6-hydroxy-4,4,6-trimethylmorpholin-4-ium-2-yl]acetic acid chloride
InChIKeyZDNWCPDGSHXFCB-JXLXBRSFSA-N
SMILESC[C@]1(C[N+](C[C@H](O1)CC(=O)O)(C)C)O.[Cl-]

Computed by PubChem (NCBI)

Synonyms: orb3173807