CAS 14173-40-1 appears in our catalog under these names: pCPA methyl ester hydrochloride/ 99.08% (existing batch purity), H–DL–Phe(4–Cl)–OMe?HCl, 4-Chloro-DL-phenylalanine methyl ester hydrochloride, DL-P-CHLOROPHENYLALANINE METHYL ESTER &, DL-P-CHLOROPHENYLALANINE METHYL ESTER. Offered by: TargetMol, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 200mg, 25g, 5g, 10g, 50g, 1G, 100mg, 250mg.
Methyl 2-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 14173-40-1) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl 2-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GCBCWTWQAFLKJG-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl 2-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GCBCWTWQAFLKJG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)