Products 23434-91-5
CAS 23434-91-5 is the registry number for PCPA methyl ester hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride (CAS 23434-91-5) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride. InChIKey: GCBCWTWQAFLKJG-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride |
| InChIKey | GCBCWTWQAFLKJG-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chloro-L-phenylalanine methyl ester hydrochloride, (S)-Methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, methyl (2S)-2-amino-3-(4-chlorophenyl)propanoate;hydrochloride, L-Methyl 4-chlorophenylalaninate hydrochloride, L-4-Chlorophenylalanine methyl ester hydrochloride, PCPA methyl ester HCl, Methyl (S)-2-amino-3-(4-chlorophenyl)propanoate hydrochloride, Methyl 2-amino-3-(4-chlorophenyl)propanoate hydrochloride, (2S)-, L-Phenylalanine, 4-chloro-, methyl ester, hydrochloride, methyl 4-chloro-L-phenylalaninate hydrochloride