CAS 14178-18-8 appears in our catalog under these names: 2-Benzyloxy-nicotinic acid, 95%, 2-(Benzyloxy)nicotinic acid, ≥95%, ≥95%, 2-Benzyloxynicotinic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg.
2-phenylmethoxypyridine-3-carboxylic acid (CAS 14178-18-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 2-phenylmethoxypyridine-3-carboxylic acid. InChIKey: FUNQFOUBLCEFIK-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-phenylmethoxypyridine-3-carboxylic acid |
| InChIKey | FUNQFOUBLCEFIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)