CAS 1423033-35-5 appears in our catalog under these names: 3-(3,4-Difluorophenyl)azetidin-3-ol hydrochloride, 95%, 3-(3,4-Difluorophenyl)azetidin-3-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-(3,4-difluorophenyl)azetidin-3-ol;hydrochloride (CAS 1423033-35-5) is a chemical compound with the molecular formula C9H10ClF2NO and a molecular weight of 221.63 g/mol. IUPAC name: 3-(3,4-difluorophenyl)azetidin-3-ol;hydrochloride. InChIKey: HGQBOBFXGHKBEM-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF2NO |
|---|---|
| Molecular weight | 221.63 g/mol |
| IUPAC name | 3-(3,4-difluorophenyl)azetidin-3-ol;hydrochloride |
| InChIKey | HGQBOBFXGHKBEM-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC(=C(C=C2)F)F)O.Cl |
Computed by PubChem (NCBI)