CAS 142547-16-8 is the registry number for Ethyl trans-2-amino-4-cyclohexene-1-carboxylate hydrochloride, 98%. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g.
Ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride (CAS 142547-16-8) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: KVUJGOVKWJWXCR-SCLLHFNJSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | ethyl (1R,6R)-6-aminocyclohex-3-ene-1-carboxylate;hydrochloride |
| InChIKey | KVUJGOVKWJWXCR-SCLLHFNJSA-N |
| SMILES | CCOC(=O)[C@@H]1CC=CC[C@H]1N.Cl |
Computed by PubChem (NCBI)