Products 1427080-99-6
CAS 1427080-99-6 is the registry number for 2,4-dichloro-3-(1,3-dioxolan-2-yl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,4-dichloro-3-(1,3-dioxolan-2-yl)pyridine (CAS 1427080-99-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2,4-dichloro-3-(1,3-dioxolan-2-yl)pyridine. InChIKey: RUJFRHBTYVNCQO-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2,4-dichloro-3-(1,3-dioxolan-2-yl)pyridine |
| InChIKey | RUJFRHBTYVNCQO-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CN=C2Cl)Cl |
Computed by PubChem (NCBI)