Products 1427373-63-4
CAS 1427373-63-4 appears in our catalog under these names: 6-Chloro-2-formyl-3-hydroxy-benzoic acid methyl ester, Methyl 6-chloro-2-formyl-3-hydroxybenzoate 95%. Offered by: Biosynth, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Methyl 6-chloro-2-formyl-3-hydroxybenzoate (CAS 1427373-63-4) is a chemical compound with the molecular formula C9H7ClO4 and a molecular weight of 214.60 g/mol. IUPAC name: methyl 6-chloro-2-formyl-3-hydroxybenzoate. InChIKey: ZUUJIDUPNJFHOH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO4 |
|---|---|
| Molecular weight | 214.60 g/mol |
| IUPAC name | methyl 6-chloro-2-formyl-3-hydroxybenzoate |
| InChIKey | ZUUJIDUPNJFHOH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1C=O)O)Cl |
Computed by PubChem (NCBI)