CAS 169674-09-3 appears in our catalog under these names: 6-Chloro-5-fluoro-1H-indole-2-carboxylic acid, 98%, 6-CHLORO-5-FLUORO-1H-INDOLE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 100mg.
6-chloro-5-fluoro-1H-indole-2-carboxylic acid (CAS 169674-09-3) is a chemical compound with the molecular formula C9H5ClFNO2 and a molecular weight of 213.59 g/mol. IUPAC name: 6-chloro-5-fluoro-1H-indole-2-carboxylic acid. InChIKey: YITFSUIVLOIUGX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFNO2 |
|---|---|
| Molecular weight | 213.59 g/mol |
| IUPAC name | 6-chloro-5-fluoro-1H-indole-2-carboxylic acid |
| InChIKey | YITFSUIVLOIUGX-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=CC(=C1F)Cl)C(=O)O |
Computed by PubChem (NCBI)