Products 1431964-86-1
CAS 1431964-86-1 is the registry number for 4-((4-Amino-1H-pyrazol-1-yl)methyl)benzoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-[(4-aminopyrazol-1-yl)methyl]benzoic acid;hydrochloride (CAS 1431964-86-1) is a chemical compound with the molecular formula C11H12ClN3O2 and a molecular weight of 253.68 g/mol. IUPAC name: 4-[(4-aminopyrazol-1-yl)methyl]benzoic acid;hydrochloride. InChIKey: DZCRRQICFFYBTQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClN3O2 |
|---|---|
| Molecular weight | 253.68 g/mol |
| IUPAC name | 4-[(4-aminopyrazol-1-yl)methyl]benzoic acid;hydrochloride |
| InChIKey | DZCRRQICFFYBTQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=C(C=N2)N)C(=O)O.Cl |
Computed by PubChem (NCBI)