Products 1432680-10-8
CAS 1432680-10-8 is the registry number for 2-(Chloromethyl)-5-methoxy-3H-imidazo(4,5-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine (CAS 1432680-10-8) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 2-(chloromethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine. InChIKey: YJFNTWVMDQOORI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methoxy-1H-imidazo[4,5-b]pyridine |
| InChIKey | YJFNTWVMDQOORI-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)NC(=N2)CCl |
Computed by PubChem (NCBI)