CAS 1437312-03-2 is the registry number for 8-(Chloromethyl)-4h-1,3-benzodioxine-6-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-(chloromethyl)-4H-1,3-benzodioxine-6-carbaldehyde (CAS 1437312-03-2) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 8-(chloromethyl)-4H-1,3-benzodioxine-6-carbaldehyde. InChIKey: KKYGPQSGLFFAGI-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 8-(chloromethyl)-4H-1,3-benzodioxine-6-carbaldehyde |
| InChIKey | KKYGPQSGLFFAGI-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)C=O)CCl)OCO1 |
Computed by PubChem (NCBI)