CAS 143800-40-2 is the registry number for 2-Chloro-6-fluoro-4-methylbenzaldehyde, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S)-2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride (CAS 143800-40-2) is a chemical compound with the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.15 g/mol. IUPAC name: (2S)-2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride. InChIKey: MVPDMDQKBTYUDG-XRIOVQLTSA-N.
| Molecular formula | C12H14Cl2N2O2 |
|---|---|
| Molecular weight | 289.15 g/mol |
| IUPAC name | (2S)-2-amino-3-quinolin-3-ylpropanoic acid;dihydrochloride |
| InChIKey | MVPDMDQKBTYUDG-XRIOVQLTSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C[C@@H](C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)