Products 1446516-72-8
CAS 1446516-72-8 appears in our catalog under these names: Methyl 4-(bromomethyl)-3,5-difluorobenzoate, 95%, Methyl 4-(bromomethyl)-3,5-difluorobenzoate, 97%, 97%, METHYL 4-BROMOMETHYL-3,5-DIFLUOROBENZOATE, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 4-(bromomethyl)-3,5-difluorobenzoate (CAS 1446516-72-8) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 4-(bromomethyl)-3,5-difluorobenzoate. InChIKey: PKISEQRQCNGSCM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 4-(bromomethyl)-3,5-difluorobenzoate |
| InChIKey | PKISEQRQCNGSCM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)F)CBr)F |
Computed by PubChem (NCBI)