CAS 1451391-30-2 appears in our catalog under these names: 5–(5–Bromo–2–Methylphenyl)–1H–Tetrazole, 5-(5-Bromo-2-Methylphenyl)-1H-Tetrazole. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
5-(5-bromo-2-methylphenyl)-2H-tetrazole (CAS 1451391-30-2) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-(5-bromo-2-methylphenyl)-2H-tetrazole. InChIKey: RPUZYTLWXFFEBJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-(5-bromo-2-methylphenyl)-2H-tetrazole |
| InChIKey | RPUZYTLWXFFEBJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C2=NNN=N2 |
Computed by PubChem (NCBI)