Products 145279-04-5
CAS 145279-04-5 appears in our catalog under these names: 2-nitro-4-phenoxyphenol, 95%, 2-Nitro-4-phenoxyphenol, 2-Nitro-4-phenoxyphenol 95%, 2-Nitro-4-phenoxyphenol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-nitro-4-phenoxyphenol (CAS 145279-04-5) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-nitro-4-phenoxyphenol. InChIKey: PVFPTCXTEHFQGM-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-nitro-4-phenoxyphenol |
| InChIKey | PVFPTCXTEHFQGM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)