CAS 1452829-44-5 is the registry number for Rel-ethyl (3R,5S)-5-(4-methoxyphenyl)thiomorpholine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R,5S)-5-(4-methoxyphenyl)thiomorpholine-3-carboxylate (CAS 1452829-44-5) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: ethyl (3R,5S)-5-(4-methoxyphenyl)thiomorpholine-3-carboxylate. InChIKey: OZBLJWFXLHHIQN-OLZOCXBDSA-N.
| Molecular formula | C14H19NO3S |
|---|---|
| Molecular weight | 281.37 g/mol |
| IUPAC name | ethyl (3R,5S)-5-(4-methoxyphenyl)thiomorpholine-3-carboxylate |
| InChIKey | OZBLJWFXLHHIQN-OLZOCXBDSA-N |
| SMILES | CCOC(=O)[C@@H]1CSC[C@@H](N1)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)