Products 550371-66-9
CAS 550371-66-9 is the registry number for 2-tosyl-7-oxa-2-azaspiro[3.5]nonane, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-methylphenyl)sulfonyl-7-oxa-2-azaspiro[3.5]nonane (CAS 550371-66-9) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: 2-(4-methylphenyl)sulfonyl-7-oxa-2-azaspiro[3.5]nonane. InChIKey: GFFDVVCTQIUJPX-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3S |
|---|---|
| Molecular weight | 281.37 g/mol |
| IUPAC name | 2-(4-methylphenyl)sulfonyl-7-oxa-2-azaspiro[3.5]nonane |
| InChIKey | GFFDVVCTQIUJPX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(C2)CCOCC3 |
Computed by PubChem (NCBI)