Products 74891-63-7

CAS 74891-63-7 is the registry number for S-(4-Acetyl-3-hydroxy-2-propylphenyl) dimethylcarbamothioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

S-(4-acetyl-3-hydroxy-2-propylphenyl) N,N-dimethylcarbamothioate (CAS 74891-63-7) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: S-(4-acetyl-3-hydroxy-2-propylphenyl) N,N-dimethylcarbamothioate. InChIKey: TWNCYHSLYIINQX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3S
Molecular weight281.37 g/mol
IUPAC nameS-(4-acetyl-3-hydroxy-2-propylphenyl) N,N-dimethylcarbamothioate
InChIKeyTWNCYHSLYIINQX-UHFFFAOYSA-N
SMILESCCCC1=C(C=CC(=C1O)C(=O)C)SC(=O)N(C)C

Computed by PubChem (NCBI)