CAS 333787-88-5 is the registry number for 1-{4-((4-Methylpiperidin-1-yl)sulfonyl)phenyl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone (CAS 333787-88-5) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: 1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone. InChIKey: GLTBDTPRRVISBC-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3S |
|---|---|
| Molecular weight | 281.37 g/mol |
| IUPAC name | 1-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]ethanone |
| InChIKey | GLTBDTPRRVISBC-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)