Products 310454-57-0

CAS 310454-57-0 is the registry number for Ethyl 1-(2-(thiophen-2-yl)acetyl)piperidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylate (CAS 310454-57-0) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: ethyl 1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylate. InChIKey: NWYHIRYENVSJSF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3S
Molecular weight281.37 g/mol
IUPAC nameethyl 1-(2-thiophen-2-ylacetyl)piperidine-3-carboxylate
InChIKeyNWYHIRYENVSJSF-UHFFFAOYSA-N
SMILESCCOC(=O)C1CCCN(C1)C(=O)CC2=CC=CS2

Computed by PubChem (NCBI)