Products 1869166-58-4

CAS 1869166-58-4 is the registry number for 4-[2-(Benzyloxy)ethyl]thiomorpholine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(2-phenylmethoxyethyl)thiomorpholine-3-carboxylic acid (CAS 1869166-58-4) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: 4-(2-phenylmethoxyethyl)thiomorpholine-3-carboxylic acid. InChIKey: XHULNZQJFNBVRQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3S
Molecular weight281.37 g/mol
IUPAC name4-(2-phenylmethoxyethyl)thiomorpholine-3-carboxylic acid
InChIKeyXHULNZQJFNBVRQ-UHFFFAOYSA-N
SMILESC1CSCC(N1CCOCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)