Products 2309455-56-7

CAS 2309455-56-7 is the registry number for tert-Butyl N-(1-oxo-3,4-dihydro-2H-1λ4-benzothiopyran-6-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-oxo-3,4-dihydro-2H-thiochromen-6-yl)carbamate (CAS 2309455-56-7) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: tert-butyl N-(1-oxo-3,4-dihydro-2H-thiochromen-6-yl)carbamate. InChIKey: MPCYTTBFBUIDGB-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3S
Molecular weight281.37 g/mol
IUPAC nametert-butyl N-(1-oxo-3,4-dihydro-2H-thiochromen-6-yl)carbamate
InChIKeyMPCYTTBFBUIDGB-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC2=C(C=C1)S(=O)CCC2

Computed by PubChem (NCBI)