CAS 2387531-85-1 is the registry number for cis-1-Methyl-2-(toluene-4-sulfonyl)-2-aza-bicyclo[3.2.0]heptan-7-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(1S,5S)-1-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-ol (CAS 2387531-85-1) is a chemical compound with the molecular formula C14H19NO3S and a molecular weight of 281.37 g/mol. IUPAC name: (1S,5S)-1-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-ol. InChIKey: JAZVRFNNRACQAW-UFPXDFCQSA-N.
| Molecular formula | C14H19NO3S |
|---|---|
| Molecular weight | 281.37 g/mol |
| IUPAC name | (1S,5S)-1-methyl-2-(4-methylphenyl)sulfonyl-2-azabicyclo[3.2.0]heptan-7-ol |
| InChIKey | JAZVRFNNRACQAW-UFPXDFCQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC[C@@H]3[C@]2(C(C3)O)C |
Computed by PubChem (NCBI)