Products 1461601-05-7

CAS 1461601-05-7 is the registry number for 3-Benzamidopyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-benzamidopyridine-4-carboxylic acid (CAS 1461601-05-7) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 3-benzamidopyridine-4-carboxylic acid. InChIKey: NBRGBJYDSHESTK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H10N2O3
Molecular weight242.23 g/mol
IUPAC name3-benzamidopyridine-4-carboxylic acid
InChIKeyNBRGBJYDSHESTK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC2=C(C=CN=C2)C(=O)O

Computed by PubChem (NCBI)