CAS 146232-51-1 appears in our catalog under these names: (3R)-Tetrahydro-pyridazine-1,2,3-tricarboxylic acid 1,2-di-tert-butyl ester, (R)-1,2-bis(tert-butoxycarbonyl)hexahydropyridazine-3-carboxylic acid, 97%, 97%, (R)-1,2-bis(tert-butoxycarbonyl)hexahydropyridazine-3-carboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
(3R)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid (CAS 146232-51-1) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: (3R)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid. InChIKey: MLXHSDCSBUGOLZ-SNVBAGLBSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | (3R)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid |
| InChIKey | MLXHSDCSBUGOLZ-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](N1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)