Products 1463535-18-3

CAS 1463535-18-3 is the registry number for 4-Chloro-2-(morpholin-4-yl)-1,3-thiazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-chloro-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid (CAS 1463535-18-3) is a chemical compound with the molecular formula C8H9ClN2O3S and a molecular weight of 248.69 g/mol. IUPAC name: 4-chloro-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid. InChIKey: XEVUBSSDXQJFSR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClN2O3S
Molecular weight248.69 g/mol
IUPAC name4-chloro-2-morpholin-4-yl-1,3-thiazole-5-carboxylic acid
InChIKeyXEVUBSSDXQJFSR-UHFFFAOYSA-N
SMILESC1COCCN1C2=NC(=C(S2)C(=O)O)Cl

Computed by PubChem (NCBI)