Products 1470556-05-8

CAS 1470556-05-8 is the registry number for Methyl 1,6-dioxaspiro(2.5)octane-2-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 1,6-dioxaspiro[2.5]octane-2-carboxylate (CAS 1470556-05-8) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: methyl 1,6-dioxaspiro[2.5]octane-2-carboxylate. InChIKey: ZUDXPXOOODYPDY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12O4
Molecular weight172.18 g/mol
IUPAC namemethyl 1,6-dioxaspiro[2.5]octane-2-carboxylate
InChIKeyZUDXPXOOODYPDY-UHFFFAOYSA-N
SMILESCOC(=O)C1C2(O1)CCOCC2

Computed by PubChem (NCBI)