Products 147494-04-0
CAS 147494-04-0 appears in our catalog under these names: Methyl 2-amino-4,6-dichlorobenzoate, Methyl 2-amino-4,6-dichlorobenzoate 95%, Methyl 2-amino-4,6-dichlorobenzoate, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Methyl 2-amino-4,6-dichlorobenzoate (CAS 147494-04-0) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: methyl 2-amino-4,6-dichlorobenzoate. InChIKey: HPOHZHUZBACNRH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | methyl 2-amino-4,6-dichlorobenzoate |
| InChIKey | HPOHZHUZBACNRH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Cl)N |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-amino-4,6-dichlorobenzoate, Benzoic acid, 2-amino-4,6-dichloro-, methyl ester, Methyl 4,6-dichloroanthranilate, Methyl 2-azanyl-4,6-bis(chloranyl)benzoate, 2-amino-4,6-dichlorobenzoic acid methyl ester, HPOHZHUZBACNRH-UHFFFAOYSA-N, Methyl2-amino-4,6-dichlorobenzoate, methyl 2-amino-4,6-dichloro-benzoate, 2-amino-4,6-dichloro-benzoic acid methyl ester