CAS 148065-10-5 appears in our catalog under these names: Ethyl 2,5-dichloronicotinate, 95%, Ethyl 2,5–dichloronicotinate, Ethyl 2,5-dichloronicotinate 97%, ethyl 2,5-dichloronicotinate, 97%, 97%, ethyl 2,5-dichloronicotinate, ≥95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 500mg, 5g, 25g.
Ethyl 2,5-dichloropyridine-3-carboxylate (CAS 148065-10-5) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 2,5-dichloropyridine-3-carboxylate. InChIKey: WNYVXIWPEGGUKG-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 2,5-dichloropyridine-3-carboxylate |
| InChIKey | WNYVXIWPEGGUKG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)