CAS 1482213-28-4 appears in our catalog under these names: 5-(6-Quinolinyl)-3-Isoxazolamine, 5-(Quinolin-6-yl)-1,2-oxazol-3-amine, 5-(Quinolin-6-yl)-1,2-oxazol-3-amine, 95%. Offered by: Chemat Brand, TRC, AmBeed, Biosynth. Available pack sizes: on request, 750mg, 1g, 0,5g, 50mg.
5-quinolin-6-yl-1,2-oxazol-3-amine (CAS 1482213-28-4) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 5-quinolin-6-yl-1,2-oxazol-3-amine. InChIKey: VBWQKYAHESPYSU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 5-quinolin-6-yl-1,2-oxazol-3-amine |
| InChIKey | VBWQKYAHESPYSU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=CC(=NO3)N)N=C1 |
Computed by PubChem (NCBI)