Products 1483309-46-1
CAS 1483309-46-1 is the registry number for 2-(1,3-Dimethyl-1H-pyrazol-5-yl)-5-methyloxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,5-dimethylpyrazol-3-yl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 1483309-46-1) is a chemical compound with the molecular formula C10H11N3O3 and a molecular weight of 221.21 g/mol. IUPAC name: 2-(2,5-dimethylpyrazol-3-yl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: IXRKEUPAPHZZIH-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O3 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 2-(2,5-dimethylpyrazol-3-yl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | IXRKEUPAPHZZIH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C2=NC(=C(O2)C)C(=O)O)C |
Computed by PubChem (NCBI)