Products 1485727-79-4

CAS 1485727-79-4 is the registry number for Methyl 2-(methylamino)-3-(propan-2-yloxy)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-(methylamino)-3-propan-2-yloxypropanoate;hydrochloride (CAS 1485727-79-4) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: methyl 2-(methylamino)-3-propan-2-yloxypropanoate;hydrochloride. InChIKey: MKGPGNFAVBXWTB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18ClNO3
Molecular weight211.68 g/mol
IUPAC namemethyl 2-(methylamino)-3-propan-2-yloxypropanoate;hydrochloride
InChIKeyMKGPGNFAVBXWTB-UHFFFAOYSA-N
SMILESCC(C)OCC(C(=O)OC)NC.Cl

Computed by PubChem (NCBI)