CAS 2375248-53-4 appears in our catalog under these names: tert-Butyl (2R,3S)-2-amino-3-hydroxybutanoate hydrochloride, tert-Butyl (2R,3S)-2-amino-3-hydroxybutanoate hydrochloride 95%, tert-Butyl (2R,3S)-2-amino-3-hydroxybutanoate hydrochloride, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
Tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride (CAS 2375248-53-4) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride. InChIKey: OWBFRQWDQDYNNF-RIHPBJNCSA-N.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | tert-butyl (2R,3S)-2-amino-3-hydroxybutanoate;hydrochloride |
| InChIKey | OWBFRQWDQDYNNF-RIHPBJNCSA-N |
| SMILES | C[C@@H]([C@H](C(=O)OC(C)(C)C)N)O.Cl |
Computed by PubChem (NCBI)