CAS 1821839-04-6 appears in our catalog under these names: (S)–tert–Butyl 2–amino–3–methoxypropanoate hydrochloride, H-Ser(Me)-OtBu·HCl 97%, (S)-tert-Butyl 2-amino-3-methoxypropanoate hydrochloride, 97%, 97%, (S)-tert-Butyl 2-amino-3-methoxypropanoate hydrochloride, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
Tert-butyl (2S)-2-amino-3-methoxypropanoate;hydrochloride (CAS 1821839-04-6) is a chemical compound with the molecular formula C8H18ClNO3 and a molecular weight of 211.68 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-methoxypropanoate;hydrochloride. InChIKey: AUHBFDKEUBKBOY-RGMNGODLSA-N.
| Molecular formula | C8H18ClNO3 |
|---|---|
| Molecular weight | 211.68 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-methoxypropanoate;hydrochloride |
| InChIKey | AUHBFDKEUBKBOY-RGMNGODLSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](COC)N.Cl |
Computed by PubChem (NCBI)