CAS 148858-05-3 is the registry number for 4-(Furan-2-carbonyl)-3,4-dihydroquinoxalin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(furan-2-carbonyl)-1,3-dihydroquinoxalin-2-one (CAS 148858-05-3) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 4-(furan-2-carbonyl)-1,3-dihydroquinoxalin-2-one. InChIKey: MHLBWXVMZIFVDJ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 4-(furan-2-carbonyl)-1,3-dihydroquinoxalin-2-one |
| InChIKey | MHLBWXVMZIFVDJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2N1C(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)