CAS 149507-37-9 appears in our catalog under these names: 4-Methoxy-2,3-dimethylphenylboronic acid, 98%, 2,3-Dimethyl-4-methoxyphenylboronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
(4-methoxy-2,3-dimethylphenyl)boronic acid (CAS 149507-37-9) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-methoxy-2,3-dimethylphenyl)boronic acid. InChIKey: MJKKULUFDFFWEV-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-methoxy-2,3-dimethylphenyl)boronic acid |
| InChIKey | MJKKULUFDFFWEV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC)C)C)(O)O |
Computed by PubChem (NCBI)