Products 1497134-46-9

CAS 1497134-46-9 is the registry number for 2-(4-Bromothiophen-2-yl)cyclopropane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid (CAS 1497134-46-9) is a chemical compound with the molecular formula C8H7BrO2S and a molecular weight of 247.11 g/mol. IUPAC name: 2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid. InChIKey: VUGPCJZSPUEEBE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BrO2S
Molecular weight247.11 g/mol
IUPAC name2-(4-bromothiophen-2-yl)cyclopropane-1-carboxylic acid
InChIKeyVUGPCJZSPUEEBE-UHFFFAOYSA-N
SMILESC1C(C1C(=O)O)C2=CC(=CS2)Br

Computed by PubChem (NCBI)