CAS 15007-07-5 appears in our catalog under these names: 3,6–Dimethoxy–9H–xanthen–9–one, 3,6-Dimethoxy-9H-xanthen-9-one, 99.69%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1g, 100mg, 250mg, 25 mg, 50 mg, 100 mg.
3,6-dimethoxyxanthen-9-one (CAS 15007-07-5) is a chemical compound with the molecular formula C15H12O4 and a molecular weight of 256.25 g/mol. IUPAC name: 3,6-dimethoxyxanthen-9-one. InChIKey: XAXSPYAXUNVJBL-UHFFFAOYSA-N.
| Molecular formula | C15H12O4 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 3,6-dimethoxyxanthen-9-one |
| InChIKey | XAXSPYAXUNVJBL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)C3=C(O2)C=C(C=C3)OC |
Computed by PubChem (NCBI)