Products 1500757-33-4
CAS 1500757-33-4 appears in our catalog under these names: 5-(3-fluorobenzyl)-1H-1,2,4-triazole-3-carboxylic acid, 95%, 95%, 5-(3-Fluorobenzyl)-1H-1,2,4-triazole-3-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid (CAS 1500757-33-4) is a chemical compound with the molecular formula C10H8FN3O2 and a molecular weight of 221.19 g/mol. IUPAC name: 5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid. InChIKey: IRJNZLGUNMKGOG-UHFFFAOYSA-N.
| Molecular formula | C10H8FN3O2 |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazole-3-carboxylic acid |
| InChIKey | IRJNZLGUNMKGOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC2=NC(=NN2)C(=O)O |
Computed by PubChem (NCBI)