CAS 1505-60-8 is the registry number for 7-Methyl-1-benzothiophene-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
7-methyl-1-benzothiophene-3-carboxylic acid (CAS 1505-60-8) is a chemical compound with the molecular formula C10H8O2S and a molecular weight of 192.24 g/mol. IUPAC name: 7-methyl-1-benzothiophene-3-carboxylic acid. InChIKey: AMQYCTXRQHFOHJ-UHFFFAOYSA-N.
| Molecular formula | C10H8O2S |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 7-methyl-1-benzothiophene-3-carboxylic acid |
| InChIKey | AMQYCTXRQHFOHJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CS2)C(=O)O |
Computed by PubChem (NCBI)