CAS 1505803-98-4 is the registry number for 2-(4-Chloro-2-methylphenoxy)-3-methoxypropanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-chloro-2-methylphenoxy)-3-methoxypropanoic acid (CAS 1505803-98-4) is a chemical compound with the molecular formula C11H13ClO4 and a molecular weight of 244.67 g/mol. IUPAC name: 2-(4-chloro-2-methylphenoxy)-3-methoxypropanoic acid. InChIKey: KWSBLWJEYJZDMO-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO4 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 2-(4-chloro-2-methylphenoxy)-3-methoxypropanoic acid |
| InChIKey | KWSBLWJEYJZDMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(COC)C(=O)O |
Computed by PubChem (NCBI)