CAS 150805-77-9 is the registry number for 4-Bromo-3-fluoro-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-2-fluoro-4-phenylbenzene (CAS 150805-77-9) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-2-fluoro-4-phenylbenzene. InChIKey: QSVXXQNLMJMOPL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-phenylbenzene |
| InChIKey | QSVXXQNLMJMOPL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)