CAS 41604-19-7 appears in our catalog under these names: 4-Bromo-2-fluorobiphenyl, 98%, 4-Bromo-2-fluoro-1,1'-biphenyl, 4–Bromo–2–fluorobiphenyl, 4-Bromo-2-fluorobiphenyl, >99.0%(GC), 4-Bromo-2-fluoro-1,1'-biphenyl, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 500g, 100g, 10g, 2,5g, 250g, 5g, Get quote.
4-bromo-2-fluoro-1-phenylbenzene (CAS 41604-19-7) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 4-bromo-2-fluoro-1-phenylbenzene. InChIKey: HTRNHWBOBYFTQF-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-phenylbenzene |
| InChIKey | HTRNHWBOBYFTQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)