CAS 40641-63-2 appears in our catalog under these names: 1–(4–Bromophenyl)–2–Fluorobenzene, 4'-bromo-2-fluoro-1,1'-biphenyl. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
1-bromo-4-(2-fluorophenyl)benzene (CAS 40641-63-2) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 1-bromo-4-(2-fluorophenyl)benzene. InChIKey: IAUANGRAOJIIBJ-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 1-bromo-4-(2-fluorophenyl)benzene |
| InChIKey | IAUANGRAOJIIBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)