CAS 306935-88-6 appears in our catalog under these names: 3-Bromo-4-fluorobiphenyl, 95%, 3-Bromo-4-fluoro-1,1'-biphenyl, 97% , 3-Bromo-4-fluoro-1,1'-biphenyl, 98%, 98%, 3-BROMO-4-FLUOROBIPHENYL, 98%, 3-Bromo-4-fluoro-1,1'-biphenyl, 97%. Offered by: Combi-blocks, Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
2-bromo-1-fluoro-4-phenylbenzene (CAS 306935-88-6) is a chemical compound with the molecular formula C12H8BrF and a molecular weight of 251.09 g/mol. IUPAC name: 2-bromo-1-fluoro-4-phenylbenzene. InChIKey: COWXPZSVUXHAFS-UHFFFAOYSA-N.
| Molecular formula | C12H8BrF |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | 2-bromo-1-fluoro-4-phenylbenzene |
| InChIKey | COWXPZSVUXHAFS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)F)Br |
Computed by PubChem (NCBI)